On Target AGTR2_HUMAN 0.37209302/CHEMBL216515
For the given ligand C64, we have found in our database that, being scored 0.37209302, the most similar ligand is CHEMBL216515. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL216515 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | CCCCOC(=O)NS(=O)(=O)c1ccc(OC(C)C)cc1c2ccc(Cn3ccnc3)cc2 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 04002012 40c04209 21000108 04b10700 00081040 00000020 02000000 80001000 00000108 000028c0 0000a009 60008000 8088980a 00010181 89300081 001c000c 020220c0 02000000 04480800 10027201 80000000 18008c00 31200040 89480018 0000a004 80000082 80880000 000000ce 04004600 2046004a 400c5000 00010660 |