On Target NPY5R_HUMAN 0.49275362/CHEMBL16965
For the given ligand C64, we have found in our database that, being scored 0.49275362, the most similar ligand is CHEMBL16965. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL16965 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | Nc1nc(NCc2cccc(CNS(=O)(=O)c3cccc4ccccc34)c2)nc5ccccc15 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 00000012 00800001 01080100 09b90600 020c0009 00004000 1400a001 02001800 00000100 20001840 01302004 60009000 00000800 00400001 80200040 000c000c 00002000 02104000 00600800 00a06000 c0000000 0c008028 20800840 08600008 02000000 80000084 48000000 8000004c 00000508 20460800 40041000 000103e0 |