On Target AA2AR_HUMAN 0.37696335/CHEMBL482648
For the given ligand C64, we have found in our database that, being scored 0.37696335, the most similar ligand is CHEMBL482648. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL482648 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | CCN1C(=O)Nc2nc([nH]c2C1=O)c3ccc(cc3)S(=O)(=O)N4CCN(Cc5ccc(OC)cc5)CC4 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 000080ba 00801808 21180108 17b10600 00081068 0000c000 02069000 02081408 16400100 100118e0 0c20a00c 60018800 02009802 00d03001 812a0481 080c800c 00002000 0200a000 00600000 00426000 80000100 38008040 21802061 2a70002c 02040000 c0200004 60220000 8004002c 08004704 20460c00 c00c0802 400102e0 |