On Target DRD1_HUMAN 0.4520548/CHEMBL599487
For the given ligand C64, we have found in our database that, being scored 0.4520548, the most similar ligand is CHEMBL599487. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL599487 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | CN(Cc1ccc(cc1)[C@H]2CN(C)CCc3cc(Cl)c(O)cc23)S(=O)(=O)c4ccccc4 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 00008010 46800008 21180100 01b10600 00080020 80000000 06000401 03001001 00000180 00081840 08302000 60808800 82000826 00200001 80200000 00000008 00002200 02100000 00500000 00026200 80000000 18208100 00004000 894a0018 02002000 a0000804 40160000 c000000c 06000580 20060002 00040000 00032760 |