On Target DRD5_HUMAN 0.47712418/CHEMBL394110
For the given ligand C64, we have found in our database that, being scored 0.47712418, the most similar ligand is CHEMBL394110. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL394110 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | O=C1N(CCCCN2CCN(CC2)c3ccccc3)S(=O)(=O)c4ccccc14 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 00004012 02801800 01180120 05b10600 000c0400 00200008 04000001 22001002 00200200 00403ac0 00302004 60128000 10008802 00002001 a0700440 00000000 02042080 02100000 08400000 00006601 c0100000 38068600 20000021 1a40001e 02002000 c0000004 40000000 9000008c 09008500 20060001 a0040000 00014370 |