On Target TSHR_HUMAN 0.31111112/CHEMBL1719708
For the given ligand C64, we have found in our database that, being scored 0.31111112, the most similar ligand is CHEMBL1719708. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL1719708 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | COc1ccc(cc1CSc2ccc(NC(=O)C)cc2)C3Nc4ccccc4C(=O)N3Cc5ccccc5 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 10004206 00802a08 20022508 00110e00 10001001 50111242 32040004 02003009 00800000 20004840 01680004 6000c000 00009802 40140000 01020441 00002008 84046008 03402122 08000000 00820801 c0100100 08438600 20832000 0044001d 00100000 c0000000 18220000 80801080 00008300 00060001 90040000 c0014221 |