On Target NPFF1_HUMAN 0.3/CHEMBL3361420
For the given ligand C64, we have found in our database that, being scored 0.3, the most similar ligand is CHEMBL3361420. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL3361420 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | COc1cccc(NC2(CNC(=O)CNC(=N)N)CCN(Cc3ccccc3)CC2)c1 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 00004002 81003408 20100128 04010e00 20001000 00000000 02000000 22003008 00200440 00000be2 00200004 5003a000 0400a802 08002000 01020441 00100008 00050090 02000000 08000000 00022601 60100000 38058600 20000003 0250001a 00000000 c0000000 40000000 90000080 08008310 00060011 20044000 00020200 |