On Target GRM2_HUMAN 0.51449275/CHEMBL421406
For the given ligand C64, we have found in our database that, being scored 0.51449275, the most similar ligand is CHEMBL421406. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL421406 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | CCS(=O)(=O)N(Cc1cccnc1)c2cccc(Oc3ccccc3)c2 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 10004002 84008008 2008450a 01300610 80041000 00000000 02004001 02001000 00000080 20001840 01302404 4000c000 00000c02 08040001 81080041 0006000c 00040080 02100004 08202000 00026c00 40500080 08008800 20810000 00402020 02040080 00004000 c8000000 8020008c 00408308 00060000 00000400 80030360 |