On Target CCKAR_HUMAN 0.37096775/CHEMBL217595
For the given ligand C64, we have found in our database that, being scored 0.37096775, the most similar ligand is CHEMBL217595. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL217595 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | OC(=O)[C@H](Cc1ccccc1)NC(=O)c2ccc(Br)cc2NS(=O)(=O)c3cc4ccccc4[nH]3 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 0088c01a 0088d800 01100942 00b10600 00040080 00710002 00000000 02001004 80000880 00180840 08302005 6000b000 06048c12 80400003 816a0440 000e020c 10022000 02000802 00600008 05006201 c0000100 18228e08 23840060 8940001c 00240880 d0000100 00120020 8000000c 04000510 20060003 a0044208 48010660 |