On Target VIPR1_HUMAN 0.2303665/CHEMBL1784685
For the given ligand C64, we have found in our database that, being scored 0.2303665, the most similar ligand is CHEMBL1784685. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL1784685 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | COc1ccc(cc1)c2ccn(c3ccc(C(=O)O)c(O)c3)c2c4ccc(cc4C)C(=O)N |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 00006002 80000a09 20000108 d0090610 20001021 04026008 22240000 00081800 00100100 100008c0 10008084 60018008 81008812 00208200 21020041 880c200c 00020000 82802004 04200100 10620402 40100040 18028e20 30801000 8140000c 00040001 c0080040 08020200 00000850 0400c204 10060648 c0040a00 00000020 |