On Target CXCR2_HUMAN 0.37341774/CHEMBL376540
For the given ligand C64, we have found in our database that, being scored 0.37341774, the most similar ligand is CHEMBL376540. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL376540 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | CN(C)S(=O)(=O)c1c(C)ccc(N\C(=N\C#N)\Nc2ccccc2Br)c1O |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 00004016 44808818 21000100 00b10a40 00000200 00020000 02000000 01002001 00060000 00000842 10202004 60008040 00004012 00008009 803001d0 0000c208 00842a80 0a000000 08400000 00026300 d0020102 08002100 20020400 084b0008 0010a000 80000000 60020800 0000008c 00008490 20060004 00000008 0c014268 |