On Target NPY2R_HUMAN 0.45689654/CHEMBL1543306
For the given ligand Tramadol, we have found in our database that, being scored 0.45689654, the most similar ligand is CHEMBL1543306. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL1543306 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | CCOc1ccc(NC(=S)N2CCC(CC2)C(O)(c3ccccc3)c4ccccc4)cc1 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 04000006 01000008 2010010a 00010e00 00101000 00004000 02000004 21002009 00100d00 000808c0 08300004 50018000 00801022 00200000 01000061 00080008 00050000 02400800 08400000 00020201 40040100 18010020 21020000 00500010 00110000 a0000000 00040000 50000080 00208280 00060002 40080000 00014e08 |