On Target NPSR1_HUMAN 0.4025974/CHEMBL1801358
For the given ligand Tramadol, we have found in our database that, being scored 0.4025974, the most similar ligand is CHEMBL1801358. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL1801358 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | COc1ccc2c(c1)C(CC3CCOCC3)(c4ccc(Cl)cc4)n5ccnc25 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 0000c102 47800208 2010010a 10010700 a0081060 40002000 02040400 01081000 80000900 100818c4 08108008 40018800 03001866 21a00000 018200a1 020d100c 00800000 0e002000 00482000 00420201 80100120 38008110 21005040 81528011 00002400 e0000001 00060000 50014080 06000286 0046080a 400c0800 00020400 |