On Target CCR1_HUMAN 0.47244096/CHEMBL344324
For the given ligand Cocaine, we have found in our database that, being scored 0.47244096, the most similar ligand is CHEMBL344324. Check out the elaboration below.
| Cocaine (Given Ligand) | CHEMBL344324 (Similar Ligand) |
|---|---|
| COC(=O)C2C(OC(=O)c1ccccc1)CC3CCC2N3C | CCOC(=O)C(CCCN1CCC(O)(CC1)c2ccc(Cl)cc2)(C#N)c3ccccc3 |
|
|
|
|
|
|
| 00010000 01000800 00100100 00010700 000c0050 00204010 00000000 20000000 00000100 010008c0 00200000 50019000 1c00801a 01890000 00000000 02081008 00a20000 02000000 01c02010 00000201 00000020 18020a30 01000080 00500014 00001401 80002000 00088000 10001000 00000200 0006000e c0020000 02002200 | 00018000 01000200 00100102 00010700 00080040 00084000 00000000 20000040 00108900 000808c0 08300000 50019800 070088b6 01200000 40040000 000c100c 08c20000 02000000 04c00000 00000201 00010120 38000b20 01800480 00500010 00002401 80000000 00040000 10000000 00000200 0006000a 40002000 00022680 |