On Target MC3R_HUMAN 0.41666666/CHEMBL363019
For the given ligand Tramadol, we have found in our database that, being scored 0.41666666, the most similar ligand is CHEMBL363019. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL363019 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | COc1cccc(CC(=O)NCC2(CCCCC2)N3CCN(CC3)C(=O)[C@@H](Cc4ccc(Cl)cc4Cl)NC(=O)CCN)c1 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00008000 43003608 20110108 04010600 00001000 80000020 02000000 2000000c 00000880 000809c0 08300000 4001b980 0f00a026 20002400 c1000001 00040009 00000000 02000000 02082008 00020201 00000500 38240710 00000023 83500018 00002800 80000200 00040000 10010000 0c000200 0006001b 20026000 00022600 |