On Target DRD2_HUMAN 0.64/CHEMBL1946122
For the given ligand Tramadol, we have found in our database that, being scored 0.64, the most similar ligand is CHEMBL1946122. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL1946122 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | OC1(C[C@H]2CC[C@@H](C1)N2CCCOc3ccc(F)cc3)c4ccc(Cl)cc4 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 04008000 01000208 2010010a 02010600 00081000 02004010 02000000 20000000 00000900 000808c0 08300000 50018800 028000a6 00a01000 01000001 000c2008 00200000 02000000 00c02000 00420201 00000100 18000130 01001080 00500010 00002001 80000000 00040000 10001001 00000202 0006800a 40020000 00022640 |