On Target ADA2B_HUMAN 0.5604396/CHEMBL41
For the given ligand Tramadol, we have found in our database that, being scored 0.5604396, the most similar ligand is CHEMBL41. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL41 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | CNCCC(Oc1ccc(cc1)C(F)(F)F)c2ccccc2 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 04000000 00000208 20100108 00010600 00001000 02004000 02040400 00000000 00000900 000808d0 08300000 40008000 00800002 01010000 01000001 020c2008 00200000 02000000 00800000 00020001 00000100 18000020 01000080 00c01010 00000000 80002000 00020400 90000000 00000200 0006000a 40100000 00000640 |