On Target GRM5_HUMAN 0.49484536/CHEMBL1289626
For the given ligand Tramadol, we have found in our database that, being scored 0.49484536, the most similar ligand is CHEMBL1289626. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL1289626 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | OC1CN(CCCCc2ccccc2)CCc3cc(O)ccc13 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00000000 43000008 20100102 00010600 000000a0 80004000 02000000 20000001 00100980 000808c0 08300000 40818800 00000002 00200000 00080000 00080008 10000200 02100000 00000000 00020201 00000900 18200020 02004000 81500010 00000000 80000200 00520000 10000000 04000000 00060002 40000000 00002600 |