On Target NPBW1_HUMAN 0.36809817/CHEMBL1940539
For the given ligand Tramadol, we have found in our database that, being scored 0.36809817, the most similar ligand is CHEMBL1940539. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL1940539 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | COc1ccc(cc1)C2(CCC2)N[C@@H]3CC[C@@H]([C@H](C3)c4ccsc4)C(=O)N5CCN(CC5)c6nc7ccccc7[nH]6 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00010002 01002208 2010090a 85010600 00141040 00004000 02040000 22001008 00000900 200808c0 09308204 40019080 0400881a 00603011 01001441 001c000c 00000000 02004000 02202008 00a24601 40000100 7e8086b0 21800821 32700018 00004800 c4000000 00320000 90000004 0800031a 0046180b 60069000 00c12e80 |