On Target CLTR1_HUMAN 0.35220125/CHEMBL3401686
For the given ligand Tramadol, we have found in our database that, being scored 0.35220125, the most similar ligand is CHEMBL3401686. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL3401686 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | OC(=O)CCCN1CC(Oc2c(OCc3ccc(OCCCCc4ccccc4)cc3)cccc12)C(=O)O |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 04026002 81000008 2010110a 00210702 a0181080 06006000 02040000 20000000 00060920 000808c0 08340004 5001d000 0c80c002 08210000 112a1041 0208e008 10840080 82000000 08c00010 00022601 41100100 18040a20 37400080 08c09010 00001001 80002000 28420008 10800081 00008200 0006000a 40000400 00822f80 |