On Target TSHR_HUMAN 0.3310811/CHEMBL3913851
For the given ligand Tramadol, we have found in our database that, being scored 0.3310811, the most similar ligand is CHEMBL3913851. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL3913851 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | CC(=O)N1c2ccc(NC(=O)OCCOc3ccccc3)cc2C(C)(CC1(C)C)c4ccccc4 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 0c004002 01401209 2010050a 00010600 24005020 00082040 03000000 21000000 00402a04 000808d0 08380024 40008010 00808002 00300800 01220041 001c0008 00068000 02800001 0800080a 00420201 44100100 18040e10 24002002 08400018 00040000 a1000002 00000010 508010c0 00488280 8006000b 00000080 20000600 |