On Target CCKAR_HUMAN 0.33116883/CHEMBL382051
For the given ligand Tramadol, we have found in our database that, being scored 0.33116883, the most similar ligand is CHEMBL382051. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL382051 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | CCCC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CNC(=O)[C@@H](Cc3ccccc3)NC(=O)[C@@H](N)Cc4ccc(O)cc4)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc5ccccc5)C(=O)N |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00070002 01003a08 20100100 45810610 00141200 00000000 02002000 2000000c 00400880 000908c0 08300004 4001b000 1e00880a 00402801 80000040 000c000c 00000000 02000001 00e02418 00020201 40000100 38348e18 21800083 93500018 00043801 80000000 08120000 10000000 0c000002 0006000b 20044200 00802e20 |