On Target OPRX_HUMAN 0.6966292/CHEMBL233494
For the given ligand Tramadol, we have found in our database that, being scored 0.6966292, the most similar ligand is CHEMBL233494. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL233494 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | COc1cccc(c1)C2(O)CCN(CC2)C(c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00000000 4b000208 20100108 00010600 00001000 40004000 02000000 23001000 00000900 000808c0 08300000 50018000 00000802 20000000 01000405 000c0008 00000000 02000000 00880000 00020201 00000100 18008020 01000080 00500010 00000001 e0000000 00000000 d0000000 00000380 0006000a 60040000 00000600 |