On Target 5HT4R_HUMAN 0.49655172/CHEMBL571799
For the given ligand Tramadol, we have found in our database that, being scored 0.49655172, the most similar ligand is CHEMBL571799. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL571799 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | CO[C@H]1CN(C[C@@H]2CCCC[C@@]2(O)c3cccc(OC)c3)CC[C@H]1NC(=O)c4cc(Cl)c(N)cc4OC |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 0000800a cb005e08 2010010a 80010700 00181080 40024100 06000000 22001400 00000900 001809e8 08300004 50018800 02008806 28a00000 81081445 000c2008 10000000 02000400 02c82000 00020601 40000100 180a8730 33000080 0050001c 00002001 c0000400 00900a00 90000001 00000302 0006081b e4060000 00022e00 |