On Target CCR4_HUMAN 0.2982456/CHEMBL1621896
For the given ligand Oseltamivir, we have found in our database that, being scored 0.2982456, the most similar ligand is CHEMBL1621896. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL1621896 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | COc1ccc(Br)cc1CN2CCCC(C2)C(=O)N3CCCCC3 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 00014000 21009408 20100108 00010600 00001000 00000100 02000000 22001400 40000000 001009e0 08200000 d0019000 0c008812 00000000 01000501 00002008 00000000 02000000 00000010 00020201 00000000 18048620 00008000 00500018 00001000 c0000000 00420000 90000000 00000300 00060011 24040008 08002200 |