On Target 5HT1D_HUMAN 0.46086955/CHEMBL100086
For the given ligand Oseltamivir, we have found in our database that, being scored 0.46086955, the most similar ligand is CHEMBL100086. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL100086 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | COc1cccc(CN2CCN(CC2)C3CCC(O)(CC3)c4ccc5OCOc5c4)c1 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 00000000 4f000008 2010010a 04010600 00181000 40004000 02040000 22001000 00300900 000908c0 48300000 40018000 00004802 20a02000 01000405 00288008 00000000 02000000 02482000 00020201 00040300 38008030 01000021 02548010 40000000 c0000000 00520000 b0000000 09000302 00060002 40060000 00010e00 |