On Target OPRM_HUMAN 0.5510204/CHEMBL3976681
For the given ligand Oseltamivir, we have found in our database that, being scored 0.5510204, the most similar ligand is CHEMBL3976681. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL3976681 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | COc1ccc2C[C@@H]3[C@@H]4C[C@@H](C(C)C)C(=O)C[C@]4(CCN3CC5CC5)c2c1 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 00010000 43000208 2010010a 00010600 00001020 40000002 03040000 20000001 00000880 000808c0 08300000 50819000 0400801a 21200000 01000021 02040008 00000200 02000000 02082008 00020201 00000100 18200210 00004000 81500010 00000800 80000001 00120000 10000000 04000202 0006000a 00020000 00002600 |