On Target ADRB3_HUMAN 0.4587156/CHEMBL1201237
For the given ligand Oseltamivir, we have found in our database that, being scored 0.4587156, the most similar ligand is CHEMBL1201237. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL1201237 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | CC(C)(C)NC[C@H](O)COc1cccc2C(=O)CCCc12 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 04010000 43000808 2010010a 00010600 00001080 c2008000 02000000 00000201 00000810 00080840 08300000 40009040 04808002 20200080 01204001 20082008 10200200 22008000 00882000 00020201 00400100 18020240 07004080 08400414 00000001 c0000001 00000000 00800000 00000302 00064002 80000000 00400640 |