On Target CCR1_HUMAN 0.4351852/CHEMBL143690
For the given ligand Oseltamivir, we have found in our database that, being scored 0.4351852, the most similar ligand is CHEMBL143690. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL143690 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | COc1cc(cc(OC)c1OC)C(CCCN2CCC(O)(CC2)c3ccc(Cl)cc3)C#N |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 00008001 43000208 2010010a 00010600 00001000 40004000 42040000 20000000 00100900 000808c0 08300000 50018800 020040a6 20200000 01000001 000c800c 00400000 02000004 00880000 00020a01 00000100 38000120 01800480 00500010 00002001 80000000 00160000 10000000 00000200 0006000a 44000000 00022680 |