On Target TAAR1_HUMAN 0.47663552/CHEMBL1379139
For the given ligand Oseltamivir, we have found in our database that, being scored 0.47663552, the most similar ligand is CHEMBL1379139. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL1379139 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | Cl.O=C(CCN1CCCC1Cc2ccccc2)c3ccc4OCCOc4c3 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 04000000 43000a08 2010010b 00210600 00001000 40000010 02040200 20000000 00002880 000808c0 08300000 40019000 0880c002 20200080 01204001 200c8008 00000000 02000000 00082012 00020201 00000100 18220210 04000000 89500014 00001000 80000000 00120000 10800000 04000202 0006000a 80000000 00022600 |