On Target MC3R_HUMAN 0.3561644/CHEMBL192450
For the given ligand Oseltamivir, we have found in our database that, being scored 0.3561644, the most similar ligand is CHEMBL192450. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL192450 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | NC(=N)NCCC[C@H](NC(=O)Cc1ccc2OCOc2c1)C(=O)N3C[C@H](Cc4ccccc4)C[C@H]3C(=O)NCc5ccccc5 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 00010000 43803208 2010010a 04010e00 00001000 80000010 02040000 22003008 00300a80 000908c2 48300000 4003b000 0700d81a 20202001 c1000401 00348008 00000000 02000000 00082000 00020201 80040300 38258630 00000003 83500018 40000000 c0000000 40120000 b0010000 0d000312 0006000b a00c6000 00012600 |