On Target ADA1D_HUMAN 0.46226415/CHEMBL385371
For the given ligand Oseltamivir, we have found in our database that, being scored 0.46226415, the most similar ligand is CHEMBL385371. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL385371 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | Cl.COc1ccc2ccccc2c1OCCNC[C@H]3COc4cc5CCCCc5cc4O3 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 04002000 43000008 2010010a 00210602 00001080 42000000 02040200 00000001 00002800 00080840 08300000 40008000 00804002 20200080 01281001 0208a008 10200200 02000000 00882002 00020201 00000100 18040008 17004080 08400010 00000001 80000001 00120000 00800001 00000202 0006000a 00000000 000206c0 |