On Target MSHR_HUMAN 0.3515625/CHEMBL3951584
For the given ligand Oseltamivir, we have found in our database that, being scored 0.3515625, the most similar ligand is CHEMBL3951584. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL3951584 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | CCCC[C@H](NC(=O)C)C(=O)N[C@H]1CCC(=O)NCC[C@H](NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](Cc2ccc(OC)cc2)NC(=O)[C@H](CCCN)NC1=O)C(=O)N |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 00030000 01003608 20100108 04010e00 00001000 00000000 02040000 2000200c 00200a80 000a09e2 08300000 4003b000 0600901a 00002001 81000001 00140008 00000000 02000000 00002008 00020201 00000100 382d0630 00000003 83500018 00000800 80000000 40120000 10000000 0c000210 0006001b a0084000 00802600 |