On Target GRM5_HUMAN 0.42/CHEMBL1682820
For the given ligand Oseltamivir, we have found in our database that, being scored 0.42, the most similar ligand is CHEMBL1682820. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL1682820 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | O=C1CCOc2cc(COc3ccccc3)ccc12 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 04000000 48000818 20000108 40050300 00001000 02224000 02000000 00000200 00000900 00080848 08100000 40009860 10808002 00010080 11000005 02082008 00000000 02008000 00480000 00020201 00000100 08020220 01000060 00c01014 00000000 c0002000 00000800 00000000 00000300 00020002 c0000000 00000400 |