On Target CLTR1_HUMAN 0.35454544/CHEMBL22776
For the given ligand Oseltamivir, we have found in our database that, being scored 0.35454544, the most similar ligand is CHEMBL22776. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL22776 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | O[C@H]([C@H](SCCC(=O)O)c1ccccc1CCCCCCCCc2ccccc2)C(=O)O |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 00000012 01008000 0002252a 00110200 00080040 00000002 01001000 00000001 00400800 00084840 08101000 4000d000 04019100 40240000 00040020 00080108 2c000008 02000100 00402008 00400001 00000100 08000a00 05004640 00400010 00048a00 80000011 00000000 00000000 00001002 00020822 00020000 05010400 |