On Target DRD3_HUMAN 0.5140187/CHEMBL3664834
For the given ligand Oseltamivir, we have found in our database that, being scored 0.5140187, the most similar ligand is CHEMBL3664834. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL3664834 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | OC1(CC(=O)N[C@@H]2CC[C@@H](CCN3CCC(CC3)c4cccc5OCOc45)CC2)CCCCC1 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 00010000 43001208 20100108 00010600 00081000 40000000 02000000 20000200 00200800 000808c0 48300000 50019050 1400c00a 20800000 01000001 002ca008 00000000 02000000 02c82000 00020301 00040300 18040610 01000080 00500418 40000001 c0000000 00000000 30000000 01000300 0006800b 00020000 00012608 |