On Target 5HT1E_HUMAN 0.28318584/CHEMBL2391541
For the given ligand Oseltamivir, we have found in our database that, being scored 0.28318584, the most similar ligand is CHEMBL2391541. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL2391541 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | COc1ccc2[nH]cc(CCN(CC=C)CC=C)c2c1 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 00000002 00000808 20100108 41010610 00041000 00000000 060c2000 00000400 00400080 00090840 08200004 40008000 10000806 00410000 01000041 0004000c 00000000 02000100 00200400 00020200 40000000 18208008 20800000 91400010 00042000 80000000 081a0000 00000020 04000200 00060002 04040200 02000620 |