On Target AGTR2_HUMAN 0.36942676/CHEMBL154057
For the given ligand Oseltamivir, we have found in our database that, being scored 0.36942676, the most similar ligand is CHEMBL154057. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL154057 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | COc1ccc2CN(C(Cc2c1OCc3ccccc3)C(=O)O)C(=O)C(C4CCCC4)c5ccccc5 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 04018008 47805008 2010010a 10210600 000010a0 c0004000 07041000 22001204 00000980 000808c0 08300000 4001b0c0 0780c88a 20210080 c1080481 0208a008 90000200 02008020 00482008 00020201 80020100 18208e30 03004040 81d49418 00004800 c0002001 00224000 90000000 04000302 0187000b 60066000 00002600 |