On Target DRD1_HUMAN 0.50574714/CHEMBL3800636
For the given ligand Oseltamivir, we have found in our database that, being scored 0.50574714, the most similar ligand is CHEMBL3800636. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL3800636 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | COc1cc(CCNCCc2ccc(O)c(O)c2)ccc1OCCCc3ccccc3 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 04000000 42000008 20100108 00210700 00001000 82000000 02040000 00000000 00000880 00080840 08300000 40008000 00804002 20000000 11000001 0208a008 00000000 02000000 00480000 00020201 00000100 18200000 01000040 81400010 00000000 80000000 00120000 00000000 04000200 0006000a 00000000 00002640 |