On Target TSHR_HUMAN 0.27210885/CHEMBL3913851
For the given ligand Oseltamivir, we have found in our database that, being scored 0.27210885, the most similar ligand is CHEMBL3913851. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL3913851 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | CC(=O)N1c2ccc(NC(=O)OCCOc3ccccc3)cc2C(C)(CC1(C)C)c4ccccc4 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 0c004002 01401209 2010050a 00010600 24005020 00082040 03000000 21000000 00402a04 000808d0 08380024 40008010 00808002 00300800 01220041 001c0008 00068000 02800001 0800080a 00420201 44100100 18040e10 24002002 08400018 00040000 a1000002 00000010 508010c0 00488280 8006000b 00000080 20000600 |