On Target CCKAR_HUMAN 0.30872482/CHEMBL382051
For the given ligand Oseltamivir, we have found in our database that, being scored 0.30872482, the most similar ligand is CHEMBL382051. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL382051 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | CCCC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)CNC(=O)[C@@H](Cc3ccccc3)NC(=O)[C@@H](N)Cc4ccc(O)cc4)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc5ccccc5)C(=O)N |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 00070002 01003a08 20100100 45810610 00141200 00000000 02002000 2000000c 00400880 000908c0 08300004 4001b000 1e00880a 00402801 80000040 000c000c 00000000 02000001 00e02418 00020201 40000100 38348e18 21800083 93500018 00043801 80000000 08120000 10000000 0c000002 0006000b 20044200 00802e20 |