On Target MC3R_HUMAN 0.24183007/CHEMBL193715
For the given ligand CBD, we have found in our database that, being scored 0.24183007, the most similar ligand is CHEMBL193715. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL193715 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | COc1ccc(CNC(=O)[C@@H]2C[C@@H](Cc3ccccc3)CN2C(=O)[C@H](CCCN=C(N)N)NC(=O)Cc4cccc5ccccc45)cc1 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00010000 01803208 2010010a 04010e00 00001002 00000010 02050000 22001008 00300880 000908c2 08300010 4003b000 0700881a 00202009 c1000401 00040008 00000800 02000000 00002000 00020201 80000100 38248638 00000003 83500018 00000000 c0000000 40230000 90000000 0c000302 0006000b 20046000 00002600 |