On Target 5HT5A_HUMAN 0.36697248/CHEMBL278751
For the given ligand CBD, we have found in our database that, being scored 0.36697248, the most similar ligand is CHEMBL278751. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL278751 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | CCCN(CCC)[C@@H]1CCc2c(OC)cccc2[C@@H]1C |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00000000 43000208 2010010a 00010600 00001020 c0000002 02000000 20000201 00000880 000808c0 08300000 40808040 00000002 20200000 01000001 02042008 00000200 02000000 00082000 00020201 00000100 18200000 00004000 81400410 00000000 c0000001 00000000 10000000 04000302 0006c00a 00000000 00002600 |