On Target AA1R_HUMAN 0.26666668/CHEMBL103150
For the given ligand CBD, we have found in our database that, being scored 0.26666668, the most similar ligand is CHEMBL103150. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL103150 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | CCCc1cc(O)c2ccc(C)nc2n1 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 0000000a 42000008 20004100 10010200 04040020 40004000 04000000 00000000 00000900 00080040 09108004 40808800 00000802 00d00000 00020040 020c000c 00000000 0600000c 00200008 00060201 40000500 08008028 20800000 80400110 00000000 81000200 00000040 00000000 00000004 00c20002 40040000 20240480 |