On Target MSHR_HUMAN 0.23134328/CHEMBL379054
For the given ligand CBD, we have found in our database that, being scored 0.23134328, the most similar ligand is CHEMBL379054. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL379054 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | CNC(=O)[C@H](Cc1ccc2ccccc2c1)N3CCN([C@@H](CCCN=C(N)N)C3=O)C(=O)[C@@H](Cc4ccccc4)NC(=O)[C@H](Cc5ccc(O)cc5)NC(=O)C |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00010000 01003208 20100100 04010e00 00000002 00000000 02010000 2000000c 00200880 000808c2 08300010 4003b000 06008012 00002009 80000000 00040008 00000800 02000000 00000008 00020201 00000100 38240628 00000023 83500018 00000800 80000000 40130000 10000000 0c000000 0006000b 20004000 00002600 |