On Target GRM5_HUMAN 0.34579438/CHEMBL1289626
For the given ligand CBD, we have found in our database that, being scored 0.34579438, the most similar ligand is CHEMBL1289626. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL1289626 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | OC1CN(CCCCc2ccccc2)CCc3cc(O)ccc13 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00000000 43000008 20100102 00010600 000000a0 80004000 02000000 20000001 00100980 000808c0 08300000 40818800 00000002 00200000 00080000 00080008 10000200 02100000 00000000 00020201 00000900 18200020 02004000 81500010 00000000 80000200 00520000 10000000 04000000 00060002 40000000 00002600 |