On Target TSHR_HUMAN 0.23563218/CHEMBL3897841
For the given ligand CBD, we have found in our database that, being scored 0.23563218, the most similar ligand is CHEMBL3897841. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL3897841 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | CC(=O)N1CCC(C)(C2C=C(NC(=O)OC3CCCC3)C=CC12)c4ccccc4 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00400030 09449200 0a100102 00110700 480e0000 00300001 00180000 a0000414 00000e00 001808ca 08340040 54418220 00028102 00210100 00002400 001e010c 20830000 03000142 40412880 00000201 00008900 18040e10 41008000 0050021a 00000000 80003002 00484800 90240100 10000200 010e140b ac000000 42012600 |