On Target EDNRA_HUMAN 0.45049506/CHEMBL435385
For the given ligand Cilostazol, we have found in our database that, being scored 0.45049506, the most similar ligand is CHEMBL435385. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL435385 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | CCOc1ccc(cc1)[C@H]2[C@@H]([C@H](CN2CC(=O)Nc3c(CC)cccc3CC)c4ccc5OCOc5c4)C(=O)O |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 0402c002 43000208 2010012a 04010600 00101001 c0000050 02040000 22001000 00300880 00090ac0 48380024 4001b000 0e80c802 20302000 81020441 002e8008 00248000 02000000 08c80018 00020201 40140300 38208e00 210020c1 83500012 40001801 c0000000 00320010 b0801080 0d088300 0006000b 20044000 20812e00 |