On Target GRM6_HUMAN 0.24017467/CHEMBL1585091
For the given ligand Cilostazol, we have found in our database that, being scored 0.24017467, the most similar ligand is CHEMBL1585091. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL1585091 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | COC(=O)c1ccc(cc1)n2c(C)cc(C(=O)CSc3ccc(NC(=O)C)cc3)c2C |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 00004002 00803a00 000a0100 d0190611 00014060 4000c800 00002000 0000100c 00520100 010a48d0 00680004 60018000 80018800 00358200 020200c0 0a0c000c 04060400 82800004 08200500 00000000 c4100000 18068e20 20806001 8740001d 00042000 c0002040 08000000 048018d0 04008206 1006004b d0040200 01010220 |