On Target NPY2R_HUMAN 0.38235295/CHEMBL1543306
For the given ligand Cilostazol, we have found in our database that, being scored 0.38235295, the most similar ligand is CHEMBL1543306. Check out the elaboration below.
| Cilostazol (Given Ligand) | CHEMBL1543306 (Similar Ligand) |
|---|---|
| O=C4CCc3cc(OCCCCc1nnnn1C2CCCCC2)ccc3N4 | CCOc1ccc(NC(=S)N2CCC(CC2)C(O)(c3ccccc3)c4ccccc4)cc1 |
|
|
|
|
|
|
| 04004002 43000218 60301108 00010700 30081000 42002048 06000000 20080308 00000800 100808c0 08388024 40019040 048080a6 20902080 51030241 000c200c 00848000 06000800 0a482008 00860201 40160100 18000610 21002000 00500410 00040800 c1000000 00040010 10001080 00008204 0006400b 80000000 28000e00 | 04000006 01000008 2010010a 00010e00 00101000 00004000 02000004 21002009 00100d00 000808c0 08300004 50018000 00801022 00200000 01000061 00080008 00050000 02400800 08400000 00020201 40040100 18010020 21020000 00500010 00110000 a0000000 00040000 50000080 00208280 00060002 40080000 00014e08 |